C10H22O2 — CID 16752205
(2R,4R)-decane-2,4-diol (PubChem CID 16752205) has the molecular formula C10H22O2 and a molecular weight of 174.28 g/mol. Its IUPAC name is (2R,4R)-decane-2,4-diol.
| Compound Name | (2R,4R)-decane-2,4-diol |
|---|---|
| PubChem CID | 16752205 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | (2R,4R)-decane-2,4-diol |
| SMILES | CCCCCC[C@@H](O)C[C@@H](C)O |
| InChI | InChI=1S/C10H22O2/c1-3-4-5-6-7-10(12)8-9(2)11/h9-12H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | AMJXRWSHIASCAM-NXEZZACHSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|