About icosan-9-ol
icosan-9-ol (PubChem CID 11983377) has the molecular formula C20H42O
and a molecular weight of 298.55 g/mol. Its IUPAC name is icosan-9-ol.
Molecular Properties
| Compound Name | icosan-9-ol |
| PubChem CID | 11983377 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | icosan-9-ol |
| SMILES | CCCCCCCCCCCC(O)CCCCCCCC |
| InChI | InChI=1S/C20H42O/c1-3-5-7-9-11-12-13-15-17-19-20(21)18-16-14-10-8-6-4-2/h20-21H,3-19H2,1-2H3 |
| InChIKey | ONNSSMGRFLULCC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze icosan-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icosan-9-ol?
The IUPAC name of icosan-9-ol (CID 11983377) is icosan-9-ol.
What is the SMILES notation for icosan-9-ol?
The canonical SMILES for icosan-9-ol is CCCCCCCCCCCC(O)CCCCCCCC.
What is the InChIKey of icosan-9-ol?
The InChIKey is ONNSSMGRFLULCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O/c1-3-5-7-9-11-12-13-15-17-19-20(21)18-16-14-10-8-6-4-2/h20-21H,3-19H2,1-2H3.
What are the key properties of icosan-9-ol?
icosan-9-ol has a molecular weight of 298.55 g/mol, XLogP of 7.02, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for icosan-9-ol is sourced from PubChem (CID 11983377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).