About tetracosan-6-ol
tetracosan-6-ol (PubChem CID 154265400) has the molecular formula C24H50O
and a molecular weight of 354.66 g/mol. Its IUPAC name is tetracosan-6-ol.
Molecular Properties
| Compound Name | tetracosan-6-ol |
| PubChem CID | 154265400 |
| Molecular Formula | C24H50O |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 354.39 |
| IUPAC Name | tetracosan-6-ol |
| SMILES | CCCCCCCCCCCCCCCCCCC(O)CCCCC |
| InChI | InChI=1S/C24H50O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23-24(25)22-20-6-4-2/h24-25H,3-23H2,1-2H3 |
| InChIKey | SENGFEBHJYCRBL-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetracosan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracosan-6-ol?
The IUPAC name of tetracosan-6-ol (CID 154265400) is tetracosan-6-ol.
What is the SMILES notation for tetracosan-6-ol?
The canonical SMILES for tetracosan-6-ol is CCCCCCCCCCCCCCCCCCC(O)CCCCC.
What is the InChIKey of tetracosan-6-ol?
The InChIKey is SENGFEBHJYCRBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23-24(25)22-20-6-4-2/h24-25H,3-23H2,1-2H3.
What are the key properties of tetracosan-6-ol?
tetracosan-6-ol has a molecular weight of 354.66 g/mol, XLogP of 8.58, 21 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracosan-6-ol is sourced from PubChem (CID 154265400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).