C12H26O2 — CID 12060471
(5S,7R)-dodecane-5,7-diol (PubChem CID 12060471) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is (5S,7R)-dodecane-5,7-diol.
| Compound Name | (5S,7R)-dodecane-5,7-diol |
|---|---|
| PubChem CID | 12060471 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | (5S,7R)-dodecane-5,7-diol |
| SMILES | CCCCC[C@@H](O)C[C@@H](O)CCCC |
| InChI | InChI=1S/C12H26O2/c1-3-5-7-9-12(14)10-11(13)8-6-4-2/h11-14H,3-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | PPVPTVZMHBBRHN-NWDGAFQWSA-N |
| XLogP | 2.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|