About nonane-3,5-diol;scandium
nonane-3,5-diol;scandium (PubChem CID 164810293) has the molecular formula C9H20O2Sc
and a molecular weight of 205.21 g/mol. Its IUPAC name is nonane-3,5-diol;scandium.
Molecular Properties
| Compound Name | nonane-3,5-diol;scandium |
| PubChem CID | 164810293 |
| Molecular Formula | C9H20O2Sc |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | nonane-3,5-diol;scandium |
| SMILES | CCCCC(O)CC(O)CC.[Sc] |
| InChI | InChI=1S/C9H20O2.Sc/c1-3-5-6-9(11)7-8(10)4-2;/h8-11H,3-7H2,1-2H3; |
| InChIKey | LYBMVGDGAIJQCW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze nonane-3,5-diol;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonane-3,5-diol;scandium?
The IUPAC name of nonane-3,5-diol;scandium (CID 164810293) is nonane-3,5-diol;scandium.
What is the SMILES notation for nonane-3,5-diol;scandium?
The canonical SMILES for nonane-3,5-diol;scandium is CCCCC(O)CC(O)CC.[Sc].
What is the InChIKey of nonane-3,5-diol;scandium?
The InChIKey is LYBMVGDGAIJQCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2.Sc/c1-3-5-6-9(11)7-8(10)4-2;/h8-11H,3-7H2,1-2H3;.
What are the key properties of nonane-3,5-diol;scandium?
nonane-3,5-diol;scandium has a molecular weight of 205.21 g/mol, XLogP of 1.70, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonane-3,5-diol;scandium is sourced from PubChem (CID 164810293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).