C7H16O2 — CID 12641368
(3R,5R)-heptane-3,5-diol (PubChem CID 12641368) has the molecular formula C7H16O2 and a molecular weight of 132.20 g/mol. Its IUPAC name is (3R,5R)-heptane-3,5-diol.
| Compound Name | (3R,5R)-heptane-3,5-diol |
|---|---|
| PubChem CID | 12641368 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | (3R,5R)-heptane-3,5-diol |
| SMILES | CC[C@@H](O)C[C@H](O)CC |
| InChI | InChI=1S/C7H16O2/c1-3-6(8)5-7(9)4-2/h6-9H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | BQWORYKVVNTRAW-RNFRBKRXSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |