About (3R,5R)-heptane-3,5-diol
(3R,5R)-heptane-3,5-diol (PubChem CID 12641368) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is (3R,5R)-heptane-3,5-diol.
Molecular Properties
| Compound Name | (3R,5R)-heptane-3,5-diol |
| PubChem CID | 12641368 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | (3R,5R)-heptane-3,5-diol |
| SMILES | CC[C@@H](O)C[C@H](O)CC |
| InChI | InChI=1S/C7H16O2/c1-3-6(8)5-7(9)4-2/h6-9H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | BQWORYKVVNTRAW-RNFRBKRXSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,5R)-heptane-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-heptane-3,5-diol?
The IUPAC name of (3R,5R)-heptane-3,5-diol (CID 12641368) is (3R,5R)-heptane-3,5-diol.
What is the SMILES notation for (3R,5R)-heptane-3,5-diol?
The canonical SMILES for (3R,5R)-heptane-3,5-diol is CC[C@@H](O)C[C@H](O)CC.
What is the InChIKey of (3R,5R)-heptane-3,5-diol?
The InChIKey is BQWORYKVVNTRAW-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H16O2/c1-3-6(8)5-7(9)4-2/h6-9H,3-5H2,1-2H3/t6-,7-/m1/s1.
What are the key properties of (3R,5R)-heptane-3,5-diol?
(3R,5R)-heptane-3,5-diol has a molecular weight of 132.20 g/mol, XLogP of 0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-heptane-3,5-diol is sourced from PubChem (CID 12641368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).