About pentan-3-ol;dihydrochloride
pentan-3-ol;dihydrochloride (PubChem CID 141116397) has the molecular formula C5H14Cl2O
and a molecular weight of 161.07 g/mol. Its IUPAC name is pentan-3-ol;dihydrochloride.
Molecular Properties
| Compound Name | pentan-3-ol;dihydrochloride |
| PubChem CID | 141116397 |
| Molecular Formula | C5H14Cl2O |
| Molecular Weight | 161.07 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | pentan-3-ol;dihydrochloride |
| SMILES | CCC(O)CC.Cl.Cl |
| InChI | InChI=1S/C5H12O.2ClH/c1-3-5(6)4-2;;/h5-6H,3-4H2,1-2H3;2*1H |
| InChIKey | DPIIKNUKLVFJQS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.07 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pentan-3-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-ol;dihydrochloride?
The IUPAC name of pentan-3-ol;dihydrochloride (CID 141116397) is pentan-3-ol;dihydrochloride.
What is the SMILES notation for pentan-3-ol;dihydrochloride?
The canonical SMILES for pentan-3-ol;dihydrochloride is CCC(O)CC.Cl.Cl.
What is the InChIKey of pentan-3-ol;dihydrochloride?
The InChIKey is DPIIKNUKLVFJQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.2ClH/c1-3-5(6)4-2;;/h5-6H,3-4H2,1-2H3;2*1H.
What are the key properties of pentan-3-ol;dihydrochloride?
pentan-3-ol;dihydrochloride has a molecular weight of 161.07 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-ol;dihydrochloride is sourced from PubChem (CID 141116397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).