About 1-fluorobutan-2-ol
1-fluorobutan-2-ol (PubChem CID 13278453) has the molecular formula C4H9FO
and a molecular weight of 92.11 g/mol. Its IUPAC name is 1-fluorobutan-2-ol.
Molecular Properties
| Compound Name | 1-fluorobutan-2-ol |
| PubChem CID | 13278453 |
| Molecular Formula | C4H9FO |
| Molecular Weight | 92.11 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | 1-fluorobutan-2-ol |
| SMILES | CCC(O)CF |
| InChI | InChI=1S/C4H9FO/c1-2-4(6)3-5/h4,6H,2-3H2,1H3 |
| InChIKey | MPGNSGYTEYWFIS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.11 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluorobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorobutan-2-ol?
The IUPAC name of 1-fluorobutan-2-ol (CID 13278453) is 1-fluorobutan-2-ol.
What is the SMILES notation for 1-fluorobutan-2-ol?
The canonical SMILES for 1-fluorobutan-2-ol is CCC(O)CF.
What is the InChIKey of 1-fluorobutan-2-ol?
The InChIKey is MPGNSGYTEYWFIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9FO/c1-2-4(6)3-5/h4,6H,2-3H2,1H3.
What are the key properties of 1-fluorobutan-2-ol?
1-fluorobutan-2-ol has a molecular weight of 92.11 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobutan-2-ol is sourced from PubChem (CID 13278453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).