About butane-1,2-diol;hydrochloride
butane-1,2-diol;hydrochloride (PubChem CID 141185193) has the molecular formula C4H11ClO2
and a molecular weight of 126.58 g/mol. Its IUPAC name is butane-1,2-diol;hydrochloride.
Molecular Properties
| Compound Name | butane-1,2-diol;hydrochloride |
| PubChem CID | 141185193 |
| Molecular Formula | C4H11ClO2 |
| Molecular Weight | 126.58 g/mol |
| Exact Mass | 126.04 |
| IUPAC Name | butane-1,2-diol;hydrochloride |
| SMILES | CCC(O)CO.Cl |
| InChI | InChI=1S/C4H10O2.ClH/c1-2-4(6)3-5;/h4-6H,2-3H2,1H3;1H |
| InChIKey | OUWYHIZTVYRLNP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.58 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane-1,2-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,2-diol;hydrochloride?
The IUPAC name of butane-1,2-diol;hydrochloride (CID 141185193) is butane-1,2-diol;hydrochloride.
What is the SMILES notation for butane-1,2-diol;hydrochloride?
The canonical SMILES for butane-1,2-diol;hydrochloride is CCC(O)CO.Cl.
What is the InChIKey of butane-1,2-diol;hydrochloride?
The InChIKey is OUWYHIZTVYRLNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.ClH/c1-2-4(6)3-5;/h4-6H,2-3H2,1H3;1H.
What are the key properties of butane-1,2-diol;hydrochloride?
butane-1,2-diol;hydrochloride has a molecular weight of 126.58 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,2-diol;hydrochloride is sourced from PubChem (CID 141185193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).