C4H12N2O8 — CID 86200178
butane-1,2-diol;bis(nitric acid) (PubChem CID 86200178) has the molecular formula C4H12N2O8 and a molecular weight of 216.15 g/mol. Its IUPAC name is butane-1,2-diol;bis(nitric acid).
| Compound Name | butane-1,2-diol;bis(nitric acid) |
|---|---|
| PubChem CID | 86200178 |
| Molecular Formula | C4H12N2O8 |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | butane-1,2-diol;bis(nitric acid) |
| SMILES | CCC(O)CO.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C4H10O2.2HNO3/c1-2-4(6)3-5;2*2-1(3)4/h4-6H,2-3H2,1H3;2*(H,2,3,4) |
| InChIKey | YYFFWCHQBFTWCW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|