C6H18O2 — CID 158754649
butane-1,2-diol;methane (PubChem CID 158754649) has the molecular formula C6H18O2 and a molecular weight of 122.21 g/mol. Its IUPAC name is butane-1,2-diol;methane.
| Compound Name | butane-1,2-diol;methane |
|---|---|
| PubChem CID | 158754649 |
| Molecular Formula | C6H18O2 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.13 |
| IUPAC Name | butane-1,2-diol;methane |
| SMILES | C.C.CCC(O)CO |
| InChI | InChI=1S/C4H10O2.2CH4/c1-2-4(6)3-5;;/h4-6H,2-3H2,1H3;2*1H4 |
| InChIKey | INXKIBMSSBLIQL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |