C7H18O4 — CID 87697932
butane-1,2-diol;propane-1,1-diol (PubChem CID 87697932) has the molecular formula C7H18O4 and a molecular weight of 166.22 g/mol. Its IUPAC name is butane-1,2-diol;propane-1,1-diol.
| Compound Name | butane-1,2-diol;propane-1,1-diol |
|---|---|
| PubChem CID | 87697932 |
| Molecular Formula | C7H18O4 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | butane-1,2-diol;propane-1,1-diol |
| SMILES | CCC(O)CO.CCC(O)O |
| InChI | InChI=1S/C4H10O2.C3H8O2/c1-2-4(6)3-5;1-2-3(4)5/h4-6H,2-3H2,1H3;3-5H,2H2,1H3 |
| InChIKey | QRLIBUQZWOLDDV-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|