About (2S)-2-bromopropan-1-ol;nitric acid
(2S)-2-bromopropan-1-ol;nitric acid (PubChem CID 71377270) has the molecular formula C3H8BrNO4
and a molecular weight of 202.00 g/mol. Its IUPAC name is (2S)-2-bromopropan-1-ol;nitric acid.
Molecular Properties
| Compound Name | (2S)-2-bromopropan-1-ol;nitric acid |
| PubChem CID | 71377270 |
| Molecular Formula | C3H8BrNO4 |
| Molecular Weight | 202.00 g/mol |
| Exact Mass | 200.96 |
| IUPAC Name | (2S)-2-bromopropan-1-ol;nitric acid |
| SMILES | C[C@H](Br)CO.O=[N+]([O-])O |
| InChI | InChI=1S/C3H7BrO.HNO3/c1-3(4)2-5;2-1(3)4/h3,5H,2H2,1H3;(H,2,3,4)/t3-;/m0./s1 |
| InChIKey | WFEIYHSGCLXOTO-DFWYDOINSA-N |
| XLogP | 0.41 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.00 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-bromopropan-1-ol;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-bromopropan-1-ol;nitric acid?
The IUPAC name of (2S)-2-bromopropan-1-ol;nitric acid (CID 71377270) is (2S)-2-bromopropan-1-ol;nitric acid.
What is the SMILES notation for (2S)-2-bromopropan-1-ol;nitric acid?
The canonical SMILES for (2S)-2-bromopropan-1-ol;nitric acid is C[C@H](Br)CO.O=[N+]([O-])O.
What is the InChIKey of (2S)-2-bromopropan-1-ol;nitric acid?
The InChIKey is WFEIYHSGCLXOTO-DFWYDOINSA-N. The full InChI is InChI=1S/C3H7BrO.HNO3/c1-3(4)2-5;2-1(3)4/h3,5H,2H2,1H3;(H,2,3,4)/t3-;/m0./s1.
What are the key properties of (2S)-2-bromopropan-1-ol;nitric acid?
(2S)-2-bromopropan-1-ol;nitric acid has a molecular weight of 202.00 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-bromopropan-1-ol;nitric acid is sourced from PubChem (CID 71377270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).