About sodium;propane-1,2-diol;nitrate
sodium;propane-1,2-diol;nitrate (PubChem CID 174898627) has the molecular formula C3H8NNaO5
and a molecular weight of 161.09 g/mol. Its IUPAC name is sodium;propane-1,2-diol;nitrate.
Molecular Properties
| Compound Name | sodium;propane-1,2-diol;nitrate |
| PubChem CID | 174898627 |
| Molecular Formula | C3H8NNaO5 |
| Molecular Weight | 161.09 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | sodium;propane-1,2-diol;nitrate |
| SMILES | CC(O)CO.O=[N+]([O-])[O-].[Na+] |
| InChI | InChI=1S/C3H8O2.NO3.Na/c1-3(5)2-4;2-1(3)4;/h3-5H,2H2,1H3;;/q;-1;+1 |
| InChIKey | FMYCGBAEZUSWTP-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.09 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;propane-1,2-diol;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;propane-1,2-diol;nitrate?
The IUPAC name of sodium;propane-1,2-diol;nitrate (CID 174898627) is sodium;propane-1,2-diol;nitrate.
What is the SMILES notation for sodium;propane-1,2-diol;nitrate?
The canonical SMILES for sodium;propane-1,2-diol;nitrate is CC(O)CO.O=[N+]([O-])[O-].[Na+].
What is the InChIKey of sodium;propane-1,2-diol;nitrate?
The InChIKey is FMYCGBAEZUSWTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.NO3.Na/c1-3(5)2-4;2-1(3)4;/h3-5H,2H2,1H3;;/q;-1;+1.
What are the key properties of sodium;propane-1,2-diol;nitrate?
sodium;propane-1,2-diol;nitrate has a molecular weight of 161.09 g/mol, XLogP of -3.88, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;propane-1,2-diol;nitrate is sourced from PubChem (CID 174898627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).