About magnesium;propan-2-ol;dinitrate
magnesium;propan-2-ol;dinitrate (PubChem CID 172773063) has the molecular formula C3H8MgN2O7
and a molecular weight of 208.41 g/mol. Its IUPAC name is magnesium;propan-2-ol;dinitrate.
Molecular Properties
| Compound Name | magnesium;propan-2-ol;dinitrate |
| PubChem CID | 172773063 |
| Molecular Formula | C3H8MgN2O7 |
| Molecular Weight | 208.41 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | magnesium;propan-2-ol;dinitrate |
| SMILES | CC(C)O.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Mg+2] |
| InChI | InChI=1S/C3H8O.Mg.2NO3/c1-3(2)4;;2*2-1(3)4/h3-4H,1-2H3;;;/q;+2;2*-1 |
| InChIKey | NFJLNOZASSQYEP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze magnesium;propan-2-ol;dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;propan-2-ol;dinitrate?
The IUPAC name of magnesium;propan-2-ol;dinitrate (CID 172773063) is magnesium;propan-2-ol;dinitrate.
What is the SMILES notation for magnesium;propan-2-ol;dinitrate?
The canonical SMILES for magnesium;propan-2-ol;dinitrate is CC(C)O.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Mg+2].
What is the InChIKey of magnesium;propan-2-ol;dinitrate?
The InChIKey is NFJLNOZASSQYEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.Mg.2NO3/c1-3(2)4;;2*2-1(3)4/h3-4H,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;propan-2-ol;dinitrate?
magnesium;propan-2-ol;dinitrate has a molecular weight of 208.41 g/mol, XLogP of -0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;propan-2-ol;dinitrate is sourced from PubChem (CID 172773063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).