About (2R)-3-nitrobutan-2-ol
(2R)-3-nitrobutan-2-ol (PubChem CID 57132293) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is (2R)-3-nitrobutan-2-ol.
Molecular Properties
| Compound Name | (2R)-3-nitrobutan-2-ol |
| PubChem CID | 57132293 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | (2R)-3-nitrobutan-2-ol |
| SMILES | CC([C@@H](C)O)[N+](=O)[O-] |
| InChI | InChI=1S/C4H9NO3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3/t3?,4-/m1/s1 |
| InChIKey | OJVOGABFNZDOOZ-SRBOSORUSA-N |
| XLogP | 0.03 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-nitrobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-nitrobutan-2-ol?
The IUPAC name of (2R)-3-nitrobutan-2-ol (CID 57132293) is (2R)-3-nitrobutan-2-ol.
What is the SMILES notation for (2R)-3-nitrobutan-2-ol?
The canonical SMILES for (2R)-3-nitrobutan-2-ol is CC([C@@H](C)O)[N+](=O)[O-].
What is the InChIKey of (2R)-3-nitrobutan-2-ol?
The InChIKey is OJVOGABFNZDOOZ-SRBOSORUSA-N. The full InChI is InChI=1S/C4H9NO3/c1-3(4(2)6)5(7)8/h3-4,6H,1-2H3/t3?,4-/m1/s1.
What are the key properties of (2R)-3-nitrobutan-2-ol?
(2R)-3-nitrobutan-2-ol has a molecular weight of 119.12 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-nitrobutan-2-ol is sourced from PubChem (CID 57132293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).