About 2-methyl-3-nitrobutane
2-methyl-3-nitrobutane (PubChem CID 13185641) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 2-methyl-3-nitrobutane.
Molecular Properties
| Compound Name | 2-methyl-3-nitrobutane |
| PubChem CID | 13185641 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 2-methyl-3-nitrobutane |
| SMILES | CC(C)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C5H11NO2/c1-4(2)5(3)6(7)8/h4-5H,1-3H3 |
| InChIKey | UITFXFXYGOKSEL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-nitrobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-nitrobutane?
The IUPAC name of 2-methyl-3-nitrobutane (CID 13185641) is 2-methyl-3-nitrobutane.
What is the SMILES notation for 2-methyl-3-nitrobutane?
The canonical SMILES for 2-methyl-3-nitrobutane is CC(C)C(C)[N+](=O)[O-].
What is the InChIKey of 2-methyl-3-nitrobutane?
The InChIKey is UITFXFXYGOKSEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-4(2)5(3)6(7)8/h4-5H,1-3H3.
What are the key properties of 2-methyl-3-nitrobutane?
2-methyl-3-nitrobutane has a molecular weight of 117.15 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-nitrobutane is sourced from PubChem (CID 13185641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).