About diazanium;2-methylpropan-1-olate;nitrate
diazanium;2-methylpropan-1-olate;nitrate (PubChem CID 141168982) has the molecular formula C4H17N3O4
and a molecular weight of 171.20 g/mol. Its IUPAC name is diazanium;2-methylpropan-1-olate;nitrate.
Molecular Properties
| Compound Name | diazanium;2-methylpropan-1-olate;nitrate |
| PubChem CID | 141168982 |
| Molecular Formula | C4H17N3O4 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.12 |
| IUPAC Name | diazanium;2-methylpropan-1-olate;nitrate |
| SMILES | CC(C)C[O-].O=[N+]([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C4H9O.NO3.2H3N/c1-4(2)3-5;2-1(3)4;;/h4H,3H2,1-2H3;;2*1H3/q2*-1;;/p+2 |
| InChIKey | RAZCQEKUVPVBMP-UHFFFAOYSA-P |
| XLogP | 0.52 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diazanium;2-methylpropan-1-olate;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;2-methylpropan-1-olate;nitrate?
The IUPAC name of diazanium;2-methylpropan-1-olate;nitrate (CID 141168982) is diazanium;2-methylpropan-1-olate;nitrate.
What is the SMILES notation for diazanium;2-methylpropan-1-olate;nitrate?
The canonical SMILES for diazanium;2-methylpropan-1-olate;nitrate is CC(C)C[O-].O=[N+]([O-])[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;2-methylpropan-1-olate;nitrate?
The InChIKey is RAZCQEKUVPVBMP-UHFFFAOYSA-P. The full InChI is InChI=1S/C4H9O.NO3.2H3N/c1-4(2)3-5;2-1(3)4;;/h4H,3H2,1-2H3;;2*1H3/q2*-1;;/p+2.
What are the key properties of diazanium;2-methylpropan-1-olate;nitrate?
diazanium;2-methylpropan-1-olate;nitrate has a molecular weight of 171.20 g/mol, XLogP of 0.52, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;2-methylpropan-1-olate;nitrate is sourced from PubChem (CID 141168982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).