About potassium 1-nitroethanolate
potassium 1-nitroethanolate (PubChem CID 101085217) has the molecular formula C2H4KNO3
and a molecular weight of 129.16 g/mol. Its IUPAC name is potassium 1-nitroethanolate.
Molecular Properties
| Compound Name | potassium 1-nitroethanolate |
| PubChem CID | 101085217 |
| Molecular Formula | C2H4KNO3 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 128.98 |
| IUPAC Name | potassium 1-nitroethanolate |
| SMILES | CC([O-])[N+](=O)[O-].[K+] |
| InChI | InChI=1S/C2H4NO3.K/c1-2(4)3(5)6;/h2H,1H3;/q-1;+1 |
| InChIKey | OBRGTAXKCNDADR-UHFFFAOYSA-N |
| XLogP | -4.03 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium 1-nitroethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 1-nitroethanolate?
The IUPAC name of potassium 1-nitroethanolate (CID 101085217) is potassium 1-nitroethanolate.
What is the SMILES notation for potassium 1-nitroethanolate?
The canonical SMILES for potassium 1-nitroethanolate is CC([O-])[N+](=O)[O-].[K+].
What is the InChIKey of potassium 1-nitroethanolate?
The InChIKey is OBRGTAXKCNDADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4NO3.K/c1-2(4)3(5)6;/h2H,1H3;/q-1;+1.
What are the key properties of potassium 1-nitroethanolate?
potassium 1-nitroethanolate has a molecular weight of 129.16 g/mol, XLogP of -4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1-nitroethanolate is sourced from PubChem (CID 101085217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).