About copper 1-nitroethanol
copper 1-nitroethanol (PubChem CID 87244389) has the molecular formula C2H5CuNO3+2
and a molecular weight of 154.61 g/mol. Its IUPAC name is copper 1-nitroethanol.
Molecular Properties
| Compound Name | copper 1-nitroethanol |
| PubChem CID | 87244389 |
| Molecular Formula | C2H5CuNO3+2 |
| Molecular Weight | 154.61 g/mol |
| Exact Mass | 153.96 |
| IUPAC Name | copper 1-nitroethanol |
| SMILES | CC(O)[N+](=O)[O-].[Cu+2] |
| InChI | InChI=1S/C2H5NO3.Cu/c1-2(4)3(5)6;/h2,4H,1H3;/q;+2 |
| InChIKey | SZAACFFMLHDUAC-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.61 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper 1-nitroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper 1-nitroethanol?
The IUPAC name of copper 1-nitroethanol (CID 87244389) is copper 1-nitroethanol.
What is the SMILES notation for copper 1-nitroethanol?
The canonical SMILES for copper 1-nitroethanol is CC(O)[N+](=O)[O-].[Cu+2].
What is the InChIKey of copper 1-nitroethanol?
The InChIKey is SZAACFFMLHDUAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO3.Cu/c1-2(4)3(5)6;/h2,4H,1H3;/q;+2.
What are the key properties of copper 1-nitroethanol?
copper 1-nitroethanol has a molecular weight of 154.61 g/mol, XLogP of -0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper 1-nitroethanol is sourced from PubChem (CID 87244389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).