About azane;1-nitroethanol
azane;1-nitroethanol (PubChem CID 88789428) has the molecular formula C2H8N2O3
and a molecular weight of 108.10 g/mol. Its IUPAC name is azane;1-nitroethanol.
Molecular Properties
| Compound Name | azane;1-nitroethanol |
| PubChem CID | 88789428 |
| Molecular Formula | C2H8N2O3 |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.05 |
| IUPAC Name | azane;1-nitroethanol |
| SMILES | CC(O)[N+](=O)[O-].N |
| InChI | InChI=1S/C2H5NO3.H3N/c1-2(4)3(5)6;/h2,4H,1H3;1H3 |
| InChIKey | OTFAUBUKSIHQHJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;1-nitroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-nitroethanol?
The IUPAC name of azane;1-nitroethanol (CID 88789428) is azane;1-nitroethanol.
What is the SMILES notation for azane;1-nitroethanol?
The canonical SMILES for azane;1-nitroethanol is CC(O)[N+](=O)[O-].N.
What is the InChIKey of azane;1-nitroethanol?
The InChIKey is OTFAUBUKSIHQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO3.H3N/c1-2(4)3(5)6;/h2,4H,1H3;1H3.
What are the key properties of azane;1-nitroethanol?
azane;1-nitroethanol has a molecular weight of 108.10 g/mol, XLogP of -0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-nitroethanol is sourced from PubChem (CID 88789428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).