About (2R)-3-nitropentan-2-ol
(2R)-3-nitropentan-2-ol (PubChem CID 57147135) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is (2R)-3-nitropentan-2-ol.
Molecular Properties
| Compound Name | (2R)-3-nitropentan-2-ol |
| PubChem CID | 57147135 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (2R)-3-nitropentan-2-ol |
| SMILES | CCC([C@@H](C)O)[N+](=O)[O-] |
| InChI | InChI=1S/C5H11NO3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3/t4-,5?/m1/s1 |
| InChIKey | CHOTTWGZEKCPHA-CNZKWPKMSA-N |
| XLogP | 0.42 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-nitropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-nitropentan-2-ol?
The IUPAC name of (2R)-3-nitropentan-2-ol (CID 57147135) is (2R)-3-nitropentan-2-ol.
What is the SMILES notation for (2R)-3-nitropentan-2-ol?
The canonical SMILES for (2R)-3-nitropentan-2-ol is CCC([C@@H](C)O)[N+](=O)[O-].
What is the InChIKey of (2R)-3-nitropentan-2-ol?
The InChIKey is CHOTTWGZEKCPHA-CNZKWPKMSA-N. The full InChI is InChI=1S/C5H11NO3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3/t4-,5?/m1/s1.
What are the key properties of (2R)-3-nitropentan-2-ol?
(2R)-3-nitropentan-2-ol has a molecular weight of 133.15 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-nitropentan-2-ol is sourced from PubChem (CID 57147135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).