About 3-nitropentan-2-yl 2-bromoacetate
3-nitropentan-2-yl 2-bromoacetate (PubChem CID 154282628) has the molecular formula C7H12BrNO4
and a molecular weight of 254.08 g/mol. Its IUPAC name is 3-nitropentan-2-yl 2-bromoacetate.
Molecular Properties
| Compound Name | 3-nitropentan-2-yl 2-bromoacetate |
| PubChem CID | 154282628 |
| Molecular Formula | C7H12BrNO4 |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 3-nitropentan-2-yl 2-bromoacetate |
| SMILES | CCC(C(C)OC(=O)CBr)[N+](=O)[O-] |
| InChI | InChI=1S/C7H12BrNO4/c1-3-6(9(11)12)5(2)13-7(10)4-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | DRVPOBPOXBCDMS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitropentan-2-yl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitropentan-2-yl 2-bromoacetate?
The IUPAC name of 3-nitropentan-2-yl 2-bromoacetate (CID 154282628) is 3-nitropentan-2-yl 2-bromoacetate.
What is the SMILES notation for 3-nitropentan-2-yl 2-bromoacetate?
The canonical SMILES for 3-nitropentan-2-yl 2-bromoacetate is CCC(C(C)OC(=O)CBr)[N+](=O)[O-].
What is the InChIKey of 3-nitropentan-2-yl 2-bromoacetate?
The InChIKey is DRVPOBPOXBCDMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BrNO4/c1-3-6(9(11)12)5(2)13-7(10)4-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-nitropentan-2-yl 2-bromoacetate?
3-nitropentan-2-yl 2-bromoacetate has a molecular weight of 254.08 g/mol, XLogP of 1.37, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitropentan-2-yl 2-bromoacetate is sourced from PubChem (CID 154282628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).