About 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate
3-methylbutan-2-yl (3R)-3-nitrooxybutanoate (PubChem CID 59614851) has the molecular formula C9H17NO5
and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate |
| PubChem CID | 59614851 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate |
| SMILES | CC(C)C(C)OC(=O)C[C@@H](C)O[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO5/c1-6(2)8(4)14-9(11)5-7(3)15-10(12)13/h6-8H,5H2,1-4H3/t7-,8?/m1/s1 |
| InChIKey | OLKMJSDTWCROJT-GVHYBUMESA-N |
| XLogP | 1.56 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate?
The IUPAC name of 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate (CID 59614851) is 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate.
What is the SMILES notation for 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate?
The canonical SMILES for 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate is CC(C)C(C)OC(=O)C[C@@H](C)O[N+](=O)[O-].
What is the InChIKey of 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate?
The InChIKey is OLKMJSDTWCROJT-GVHYBUMESA-N. The full InChI is InChI=1S/C9H17NO5/c1-6(2)8(4)14-9(11)5-7(3)15-10(12)13/h6-8H,5H2,1-4H3/t7-,8?/m1/s1.
What are the key properties of 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate?
3-methylbutan-2-yl (3R)-3-nitrooxybutanoate has a molecular weight of 219.24 g/mol, XLogP of 1.56, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl (3R)-3-nitrooxybutanoate is sourced from PubChem (CID 59614851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).