C13H28ClNO2 — CID 126809418
3-methylbutan-2-yl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (PubChem CID 126809418) has the molecular formula C13H28ClNO2 and a molecular weight of 265.82 g/mol. Its IUPAC name is 3-methylbutan-2-yl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride.
| Compound Name | 3-methylbutan-2-yl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
|---|---|
| PubChem CID | 126809418 |
| Molecular Formula | C13H28ClNO2 |
| Molecular Weight | 265.82 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-methylbutan-2-yl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| SMILES | CC(C)C[C@H](CN)CC(=O)OC(C)C(C)C.Cl |
| InChI | InChI=1S/C13H27NO2.ClH/c1-9(2)6-12(8-14)7-13(15)16-11(5)10(3)4;/h9-12H,6-8,14H2,1-5H3;1H/t11?,12-;/m0./s1 |
| InChIKey | ROJUJIWVFWZSCV-MMFRDWCLSA-N |
| XLogP | 3.01 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.82 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |