About 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride
4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (PubChem CID 122155511) has the molecular formula C12H25ClFNO2
and a molecular weight of 269.79 g/mol. Its IUPAC name is 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride.
Molecular Properties
| Compound Name | 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| PubChem CID | 122155511 |
| Molecular Formula | C12H25ClFNO2 |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| SMILES | CC(C)C[C@H](CN)CC(=O)OCCCCF.Cl |
| InChI | InChI=1S/C12H24FNO2.ClH/c1-10(2)7-11(9-14)8-12(15)16-6-4-3-5-13;/h10-11H,3-9,14H2,1-2H3;1H/t11-;/m0./s1 |
| InChIKey | PORQZXFDSUFILK-MERQFXBCSA-N |
| XLogP | 2.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The IUPAC name of 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (CID 122155511) is 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride.
What is the SMILES notation for 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The canonical SMILES for 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride is CC(C)C[C@H](CN)CC(=O)OCCCCF.Cl.
What is the InChIKey of 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The InChIKey is PORQZXFDSUFILK-MERQFXBCSA-N. The full InChI is InChI=1S/C12H24FNO2.ClH/c1-10(2)7-11(9-14)8-12(15)16-6-4-3-5-13;/h10-11H,3-9,14H2,1-2H3;1H/t11-;/m0./s1.
What are the key properties of 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride has a molecular weight of 269.79 g/mol, XLogP of 2.71, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobutyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride is sourced from PubChem (CID 122155511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).