About 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride
2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (PubChem CID 126820190) has the molecular formula C15H30ClNO3
and a molecular weight of 307.86 g/mol. Its IUPAC name is 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| PubChem CID | 126820190 |
| Molecular Formula | C15H30ClNO3 |
| Molecular Weight | 307.86 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride |
| SMILES | CC(C)C[C@H](CN)CC(=O)OCCC1CCCCO1.Cl |
| InChI | InChI=1S/C15H29NO3.ClH/c1-12(2)9-13(11-16)10-15(17)19-8-6-14-5-3-4-7-18-14;/h12-14H,3-11,16H2,1-2H3;1H/t13-,14?;/m0./s1 |
| InChIKey | CUVZOTUVLUJSNQ-GPFYXIAXSA-N |
| XLogP | 2.92 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The IUPAC name of 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride (CID 126820190) is 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride.
What is the SMILES notation for 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The canonical SMILES for 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride is CC(C)C[C@H](CN)CC(=O)OCCC1CCCCO1.Cl.
What is the InChIKey of 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
The InChIKey is CUVZOTUVLUJSNQ-GPFYXIAXSA-N. The full InChI is InChI=1S/C15H29NO3.ClH/c1-12(2)9-13(11-16)10-15(17)19-8-6-14-5-3-4-7-18-14;/h12-14H,3-11,16H2,1-2H3;1H/t13-,14?;/m0./s1.
What are the key properties of 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride?
2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride has a molecular weight of 307.86 g/mol, XLogP of 2.92, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-2-yl)ethyl (3S)-3-(aminomethyl)-5-methylhexanoate;hydrochloride is sourced from PubChem (CID 126820190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).