About 5-(oxan-2-yl)pentyl acetate
5-(oxan-2-yl)pentyl acetate (PubChem CID 66871710) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 5-(oxan-2-yl)pentyl acetate.
Molecular Properties
| Compound Name | 5-(oxan-2-yl)pentyl acetate |
| PubChem CID | 66871710 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 5-(oxan-2-yl)pentyl acetate |
| SMILES | CC(=O)OCCCCCC1CCCCO1 |
| InChI | InChI=1S/C12H22O3/c1-11(13)14-9-5-2-3-7-12-8-4-6-10-15-12/h12H,2-10H2,1H3 |
| InChIKey | YNKFMVUZLGWFNT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(oxan-2-yl)pentyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-2-yl)pentyl acetate?
The IUPAC name of 5-(oxan-2-yl)pentyl acetate (CID 66871710) is 5-(oxan-2-yl)pentyl acetate.
What is the SMILES notation for 5-(oxan-2-yl)pentyl acetate?
The canonical SMILES for 5-(oxan-2-yl)pentyl acetate is CC(=O)OCCCCCC1CCCCO1.
What is the InChIKey of 5-(oxan-2-yl)pentyl acetate?
The InChIKey is YNKFMVUZLGWFNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-11(13)14-9-5-2-3-7-12-8-4-6-10-15-12/h12H,2-10H2,1H3.
What are the key properties of 5-(oxan-2-yl)pentyl acetate?
5-(oxan-2-yl)pentyl acetate has a molecular weight of 214.30 g/mol, XLogP of 2.68, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-2-yl)pentyl acetate is sourced from PubChem (CID 66871710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).