About hexyl oxan-2-ylmethyl carbonate
hexyl oxan-2-ylmethyl carbonate (PubChem CID 67045710) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is hexyl oxan-2-ylmethyl carbonate.
Molecular Properties
| Compound Name | hexyl oxan-2-ylmethyl carbonate |
| PubChem CID | 67045710 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | hexyl oxan-2-ylmethyl carbonate |
| SMILES | CCCCCCOC(=O)OCC1CCCCO1 |
| InChI | InChI=1S/C13H24O4/c1-2-3-4-6-10-16-13(14)17-11-12-8-5-7-9-15-12/h12H,2-11H2,1H3 |
| InChIKey | PDDSDBGKROPGLH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl oxan-2-ylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl oxan-2-ylmethyl carbonate?
The IUPAC name of hexyl oxan-2-ylmethyl carbonate (CID 67045710) is hexyl oxan-2-ylmethyl carbonate.
What is the SMILES notation for hexyl oxan-2-ylmethyl carbonate?
The canonical SMILES for hexyl oxan-2-ylmethyl carbonate is CCCCCCOC(=O)OCC1CCCCO1.
What is the InChIKey of hexyl oxan-2-ylmethyl carbonate?
The InChIKey is PDDSDBGKROPGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-2-3-4-6-10-16-13(14)17-11-12-8-5-7-9-15-12/h12H,2-11H2,1H3.
What are the key properties of hexyl oxan-2-ylmethyl carbonate?
hexyl oxan-2-ylmethyl carbonate has a molecular weight of 244.33 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl oxan-2-ylmethyl carbonate is sourced from PubChem (CID 67045710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).