[2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate

C10H16F2O3 — CID 145163009

IUPAC[2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate
SMILESCC(=O)OCC(F)(F)C[C@H]1CCCCO1
InChIInChI=1S/C10H16F2O3/c1-8(13)15-7-10(11,12)6-9-4-2-3-5-14-9/h9H,2-7H2,1H3/t9-/m1/s1
InChIKeyMAACOBZLBSSKQG-SECBINFHSA-N
MW222.23 g/mol
LogP2.14
Rot. Bonds4

About [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate

[2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate (PubChem CID 145163009) has the molecular formula C10H16F2O3 and a molecular weight of 222.23 g/mol. Its IUPAC name is [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate.

Molecular Properties

Compound Name[2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate
PubChem CID145163009
Molecular FormulaC10H16F2O3
Molecular Weight222.23 g/mol
Exact Mass222.11
IUPAC Name[2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate
SMILESCC(=O)OCC(F)(F)C[C@H]1CCCCO1
InChIInChI=1S/C10H16F2O3/c1-8(13)15-7-10(11,12)6-9-4-2-3-5-14-9/h9H,2-7H2,1H3/t9-/m1/s1
InChIKeyMAACOBZLBSSKQG-SECBINFHSA-N
XLogP2.14
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.23
LogP ≤ 52.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate?
The IUPAC name of [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate (CID 145163009) is [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate.
What is the SMILES notation for [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate?
The canonical SMILES for [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate is CC(=O)OCC(F)(F)C[C@H]1CCCCO1.
What is the InChIKey of [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate?
The InChIKey is MAACOBZLBSSKQG-SECBINFHSA-N. The full InChI is InChI=1S/C10H16F2O3/c1-8(13)15-7-10(11,12)6-9-4-2-3-5-14-9/h9H,2-7H2,1H3/t9-/m1/s1.
What are the key properties of [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate?
[2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate has a molecular weight of 222.23 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate is sourced from PubChem (CID 145163009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).