C10H16F2O3 — CID 145163009
[2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate (PubChem CID 145163009) has the molecular formula C10H16F2O3 and a molecular weight of 222.23 g/mol. Its IUPAC name is [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate.
| Compound Name | [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 145163009 |
| Molecular Formula | C10H16F2O3 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [2,2-difluoro-3-[(2R)-oxan-2-yl]propyl] acetate |
| SMILES | CC(=O)OCC(F)(F)C[C@H]1CCCCO1 |
| InChI | InChI=1S/C10H16F2O3/c1-8(13)15-7-10(11,12)6-9-4-2-3-5-14-9/h9H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | MAACOBZLBSSKQG-SECBINFHSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |