C10H17F2NO2 — CID 154947097
N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]formamide (PubChem CID 154947097) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]formamide.
| Compound Name | N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]formamide |
|---|---|
| PubChem CID | 154947097 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]formamide |
| SMILES | CC(NC=O)C(F)(F)C[C@@H]1CCCCO1 |
| InChI | InChI=1S/C10H17F2NO2/c1-8(13-7-14)10(11,12)6-9-4-2-3-5-15-9/h7-9H,2-6H2,1H3,(H,13,14)/t8?,9-/m0/s1 |
| InChIKey | IAFQQCZJKACJJD-GKAPJAKFSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|