C10H16F3NO3 — CID 79799046
oxan-2-ylmethyl 2-amino-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 79799046) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is oxan-2-ylmethyl 2-amino-3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | oxan-2-ylmethyl 2-amino-3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 79799046 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | oxan-2-ylmethyl 2-amino-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | CC(N)(C(=O)OCC1CCCCO1)C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO3/c1-9(14,10(11,12)13)8(15)17-6-7-4-2-3-5-16-7/h7H,2-6,14H2,1H3 |
| InChIKey | ZFECCHTYUINQLF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |