About oxan-2-ylmethyl 2-methylbutanoate
oxan-2-ylmethyl 2-methylbutanoate (PubChem CID 78836820) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is oxan-2-ylmethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl 2-methylbutanoate |
| PubChem CID | 78836820 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | oxan-2-ylmethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC1CCCCO1 |
| InChI | InChI=1S/C11H20O3/c1-3-9(2)11(12)14-8-10-6-4-5-7-13-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | JVOQCKGHUVLAGG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxan-2-ylmethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl 2-methylbutanoate?
The IUPAC name of oxan-2-ylmethyl 2-methylbutanoate (CID 78836820) is oxan-2-ylmethyl 2-methylbutanoate.
What is the SMILES notation for oxan-2-ylmethyl 2-methylbutanoate?
The canonical SMILES for oxan-2-ylmethyl 2-methylbutanoate is CCC(C)C(=O)OCC1CCCCO1.
What is the InChIKey of oxan-2-ylmethyl 2-methylbutanoate?
The InChIKey is JVOQCKGHUVLAGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-9(2)11(12)14-8-10-6-4-5-7-13-10/h9-10H,3-8H2,1-2H3.
What are the key properties of oxan-2-ylmethyl 2-methylbutanoate?
oxan-2-ylmethyl 2-methylbutanoate has a molecular weight of 200.28 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl 2-methylbutanoate is sourced from PubChem (CID 78836820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).