About oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate
oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate (PubChem CID 107775737) has the molecular formula C11H19NO4S
and a molecular weight of 261.34 g/mol. Its IUPAC name is oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate |
| PubChem CID | 107775737 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate |
| SMILES | CC(=O)N[C@@H](CS)C(=O)OCC1CCCCO1 |
| InChI | InChI=1S/C11H19NO4S/c1-8(13)12-10(7-17)11(14)16-6-9-4-2-3-5-15-9/h9-10,17H,2-7H2,1H3,(H,12,13)/t9?,10-/m0/s1 |
| InChIKey | KKIOZOBIHNVQKW-AXDSSHIGSA-N |
| XLogP | 0.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate?
The IUPAC name of oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate (CID 107775737) is oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate.
What is the SMILES notation for oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate?
The canonical SMILES for oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate is CC(=O)N[C@@H](CS)C(=O)OCC1CCCCO1.
What is the InChIKey of oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate?
The InChIKey is KKIOZOBIHNVQKW-AXDSSHIGSA-N. The full InChI is InChI=1S/C11H19NO4S/c1-8(13)12-10(7-17)11(14)16-6-9-4-2-3-5-15-9/h9-10,17H,2-7H2,1H3,(H,12,13)/t9?,10-/m0/s1.
What are the key properties of oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate?
oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate has a molecular weight of 261.34 g/mol, XLogP of 0.53, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl (2R)-2-acetamido-3-sulfanylpropanoate is sourced from PubChem (CID 107775737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).