About oxan-2-ylmethyl 3-aminobut-2-enoate
oxan-2-ylmethyl 3-aminobut-2-enoate (PubChem CID 67941955) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is oxan-2-ylmethyl 3-aminobut-2-enoate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl 3-aminobut-2-enoate |
| PubChem CID | 67941955 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | oxan-2-ylmethyl 3-aminobut-2-enoate |
| SMILES | CC(N)=CC(=O)OCC1CCCCO1 |
| InChI | InChI=1S/C10H17NO3/c1-8(11)6-10(12)14-7-9-4-2-3-5-13-9/h6,9H,2-5,7,11H2,1H3 |
| InChIKey | LGPBWDGNWLDWNO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze oxan-2-ylmethyl 3-aminobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl 3-aminobut-2-enoate?
The IUPAC name of oxan-2-ylmethyl 3-aminobut-2-enoate (CID 67941955) is oxan-2-ylmethyl 3-aminobut-2-enoate.
What is the SMILES notation for oxan-2-ylmethyl 3-aminobut-2-enoate?
The canonical SMILES for oxan-2-ylmethyl 3-aminobut-2-enoate is CC(N)=CC(=O)OCC1CCCCO1.
What is the InChIKey of oxan-2-ylmethyl 3-aminobut-2-enoate?
The InChIKey is LGPBWDGNWLDWNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-8(11)6-10(12)14-7-9-4-2-3-5-13-9/h6,9H,2-5,7,11H2,1H3.
What are the key properties of oxan-2-ylmethyl 3-aminobut-2-enoate?
oxan-2-ylmethyl 3-aminobut-2-enoate has a molecular weight of 199.25 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl 3-aminobut-2-enoate is sourced from PubChem (CID 67941955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).