About ethene;oxolan-2-ylmethyl prop-2-enoate
ethene;oxolan-2-ylmethyl prop-2-enoate (PubChem CID 70419708) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is ethene;oxolan-2-ylmethyl prop-2-enoate.
Molecular Properties
| Compound Name | ethene;oxolan-2-ylmethyl prop-2-enoate |
| PubChem CID | 70419708 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | ethene;oxolan-2-ylmethyl prop-2-enoate |
| SMILES | C=C.C=C.C=C.C=C.C=CC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C8H12O3.4C2H4/c1-2-8(9)11-6-7-4-3-5-10-7;4*1-2/h2,7H,1,3-6H2;4*1-2H2 |
| InChIKey | QPZWYMUPHLSHOQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethene;oxolan-2-ylmethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;oxolan-2-ylmethyl prop-2-enoate?
The IUPAC name of ethene;oxolan-2-ylmethyl prop-2-enoate (CID 70419708) is ethene;oxolan-2-ylmethyl prop-2-enoate.
What is the SMILES notation for ethene;oxolan-2-ylmethyl prop-2-enoate?
The canonical SMILES for ethene;oxolan-2-ylmethyl prop-2-enoate is C=C.C=C.C=C.C=C.C=CC(=O)OCC1CCCO1.
What is the InChIKey of ethene;oxolan-2-ylmethyl prop-2-enoate?
The InChIKey is QPZWYMUPHLSHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3.4C2H4/c1-2-8(9)11-6-7-4-3-5-10-7;4*1-2/h2,7H,1,3-6H2;4*1-2H2.
What are the key properties of ethene;oxolan-2-ylmethyl prop-2-enoate?
ethene;oxolan-2-ylmethyl prop-2-enoate has a molecular weight of 268.40 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;oxolan-2-ylmethyl prop-2-enoate is sourced from PubChem (CID 70419708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).