C21H32O5 — CID 68541728
oxolan-2-ylmethyl prop-2-enoate;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate (PubChem CID 68541728) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is oxolan-2-ylmethyl prop-2-enoate;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate.
| Compound Name | oxolan-2-ylmethyl prop-2-enoate;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
|---|---|
| PubChem CID | 68541728 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | oxolan-2-ylmethyl prop-2-enoate;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC1CCCO1.C=CC(=O)O[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C13H20O2.C8H12O3/c1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3;1-2-8(9)11-6-7-4-3-5-10-7/h5,9-10H,1,6-8H2,2-4H3;2,7H,1,3-6H2/t9-,10-,13+;/m0./s1 |
| InChIKey | SMBFFBFTVJCIRH-VWKQLAEWSA-N |
| XLogP | 3.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|