C14H20O4 — CID 94860445
(Z)-4-oxo-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]but-2-enoic acid (PubChem CID 94860445) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (Z)-4-oxo-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]but-2-enoic acid |
|---|---|
| PubChem CID | 94860445 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (Z)-4-oxo-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]but-2-enoic acid |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](OC(=O)/C=C\C(=O)O)C2 |
| InChI | InChI=1S/C14H20O4/c1-13(2)9-6-7-14(13,3)10(8-9)18-12(17)5-4-11(15)16/h4-5,9-10H,6-8H2,1-3H3,(H,15,16)/b5-4-/t9-,10-,14+/m0/s1 |
| InChIKey | BITUSFVRXSZURD-WZMMYAEUSA-N |
| XLogP | 2.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|