C24H36O4 — CID 124868014
1-O-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-O-[(1R,2R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-but-2-enedioate (PubChem CID 124868014) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 1-O-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-O-[(1R,2R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-but-2-enedioate.
| Compound Name | 1-O-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-O-[(1R,2R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 124868014 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1-O-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 4-O-[(1R,2R,4R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (Z)-but-2-enedioate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C[C@H]2OC(=O)/C=C\C(=O)O[C@H]1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C24H36O4/c1-21(2)15-9-12-24(21,6)18(13-15)28-20(26)8-7-19(25)27-17-14-23(5)11-10-16(17)22(23,3)4/h7-8,15-18H,9-14H2,1-6H3/b8-7-/t15-,16+,17-,18+,23-,24-/m1/s1 |
| InChIKey | YPIKPWSXZOTIDY-VZSKEDAQSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|