C24H40O4 — CID 66836214
[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate (PubChem CID 66836214) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate.
| Compound Name | [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate |
|---|---|
| PubChem CID | 66836214 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C.CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/2C12H20O2/c2*1-8(13)14-10-7-9-5-6-12(10,4)11(9,2)3/h2*9-10H,5-7H2,1-4H3/t2*9-,10+,12+/m00/s1 |
| InChIKey | DYTSXYJULYDSMX-KBYSGDIRSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |