C22H36N2O4 — CID 10453143
[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] N-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonylamino]carbamate (PubChem CID 10453143) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] N-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonylamino]carbamate.
| Compound Name | [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] N-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 10453143 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] N-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxycarbonylamino]carbamate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](OC(=O)NNC(=O)O[C@@H]1C[C@H]3CC[C@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/C22H36N2O4/c1-19(2)13-7-9-21(19,5)15(11-13)27-17(25)23-24-18(26)28-16-12-14-8-10-22(16,6)20(14,3)4/h13-16H,7-12H2,1-6H3,(H,23,25)(H,24,26)/t13-,14-,15-,16-,21+,22+/m1/s1 |
| InChIKey | SOPRACJRDQEDIX-BJCSYRMLSA-N |
| XLogP | 4.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|