C14H24O2 — CID 134330267
ethene;[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate (PubChem CID 134330267) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is ethene;[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate.
| Compound Name | ethene;[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate |
|---|---|
| PubChem CID | 134330267 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | ethene;[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] acetate |
| SMILES | C=C.CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C12H20O2.C2H4/c1-8(13)14-10-7-9-5-6-12(10,4)11(9,2)3;1-2/h9-10H,5-7H2,1-4H3;1-2H2/t9-,10+,12+;/m0./s1 |
| InChIKey | HRLKPXUUHOHKEO-HXINOFRHSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|