C25H36O4 — CID 15965832
bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] penta-2,3-dienedioate (PubChem CID 15965832) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] penta-2,3-dienedioate.
| Compound Name | bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] penta-2,3-dienedioate |
|---|---|
| PubChem CID | 15965832 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] penta-2,3-dienedioate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](OC(=O)C=C=CC(=O)O[C@@H]1C[C@@H]3CC[C@@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/C25H36O4/c1-22(2)16-10-12-24(22,5)18(14-16)28-20(26)8-7-9-21(27)29-19-15-17-11-13-25(19,6)23(17,3)4/h8-9,16-19H,10-15H2,1-6H3/t7?,16-,17-,18+,19+,24+,25+/m0/s1 |
| InChIKey | ARXILKKHGOWRSA-MYFXJZHFSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|