C25H38O4 — CID 171775158
bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-2-methylbut-2-enedioate (PubChem CID 171775158) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-2-methylbut-2-enedioate.
| Compound Name | bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-2-methylbut-2-enedioate |
|---|---|
| PubChem CID | 171775158 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) (E)-2-methylbut-2-enedioate |
| SMILES | C/C(=C\C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C25H38O4/c1-15(21(27)29-19-14-17-9-11-25(19,7)23(17,4)5)12-20(26)28-18-13-16-8-10-24(18,6)22(16,2)3/h12,16-19H,8-11,13-14H2,1-7H3/b15-12+ |
| InChIKey | MQYIQZIQEGBUJW-NTCAYCPXSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|