C28H46O4 — CID 11374256
bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,2,3,3-tetramethylbutanedioate (PubChem CID 11374256) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,2,3,3-tetramethylbutanedioate.
| Compound Name | bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,2,3,3-tetramethylbutanedioate |
|---|---|
| PubChem CID | 11374256 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | bis[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,2,3,3-tetramethylbutanedioate |
| SMILES | CC(C)(C(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C)C(C)(C)C(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C28H46O4/c1-23(2)17-11-13-27(23,9)19(15-17)31-21(29)25(5,6)26(7,8)22(30)32-20-16-18-12-14-28(20,10)24(18,3)4/h17-20H,11-16H2,1-10H3/t17-,18-,19+,20+,27+,28+/m0/s1 |
| InChIKey | DAKLPUIAMBSHRR-NBOPTNLOSA-N |
| XLogP | 6.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |