C13H18F4O2 — CID 114033260
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,2,3,3-tetrafluoropropanoate (PubChem CID 114033260) has the molecular formula C13H18F4O2 and a molecular weight of 282.28 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,2,3,3-tetrafluoropropanoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,2,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 114033260 |
| Molecular Formula | C13H18F4O2 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2,2,3,3-tetrafluoropropanoate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)C(F)(F)C(F)F)C2 |
| InChI | InChI=1S/C13H18F4O2/c1-11(2)7-4-5-12(11,3)8(6-7)19-10(18)13(16,17)9(14)15/h7-9H,4-6H2,1-3H3 |
| InChIKey | OYNURTDSFHROEL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|