C29H46O5 — CID 11271457
bis[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,2,4,4-tetramethyl-3-oxopentanedioate (PubChem CID 11271457) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is bis[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,2,4,4-tetramethyl-3-oxopentanedioate.
| Compound Name | bis[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,2,4,4-tetramethyl-3-oxopentanedioate |
|---|---|
| PubChem CID | 11271457 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | bis[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2,2,4,4-tetramethyl-3-oxopentanedioate |
| SMILES | CC(C)(C(=O)O[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C)C(=O)C(C)(C)C(=O)O[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C29H46O5/c1-24(2,22(31)33-19-15-17-11-13-28(19,9)26(17,5)6)21(30)25(3,4)23(32)34-20-16-18-12-14-29(20,10)27(18,7)8/h17-20H,11-16H2,1-10H3/t17-,18-,19-,20-,28+,29+/m0/s1 |
| InChIKey | LULVQICOJYCWCE-DTHWLSCFSA-N |
| XLogP | 6.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|