C14H23ClO2 — CID 4241525
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-chloro-2-methylpropanoate (PubChem CID 4241525) has the molecular formula C14H23ClO2 and a molecular weight of 258.79 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-chloro-2-methylpropanoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-chloro-2-methylpropanoate |
|---|---|
| PubChem CID | 4241525 |
| Molecular Formula | C14H23ClO2 |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-chloro-2-methylpropanoate |
| SMILES | CC(C)(Cl)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C14H23ClO2/c1-12(2)9-6-7-14(12,5)10(8-9)17-11(16)13(3,4)15/h9-10H,6-8H2,1-5H3 |
| InChIKey | HWQGWETUJRSEDS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|