C26H42O4 — CID 18003095
bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) hexanedioate (PubChem CID 18003095) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) hexanedioate.
| Compound Name | bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) hexanedioate |
|---|---|
| PubChem CID | 18003095 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | bis(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) hexanedioate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)CCCCC(=O)OC1CC3CCC1(C)C3(C)C)C2 |
| InChI | InChI=1S/C26H42O4/c1-23(2)17-11-13-25(23,5)19(15-17)29-21(27)9-7-8-10-22(28)30-20-16-18-12-14-26(20,6)24(18,3)4/h17-20H,7-16H2,1-6H3 |
| InChIKey | DUAITBVISALTGV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|