C28H45NO4S — CID 174833165
[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] pentanoate;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-thiocyanatoacetate (PubChem CID 174833165) has the molecular formula C28H45NO4S and a molecular weight of 491.74 g/mol. Its IUPAC name is [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] pentanoate;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-thiocyanatoacetate.
| Compound Name | [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] pentanoate;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-thiocyanatoacetate |
|---|---|
| PubChem CID | 174833165 |
| Molecular Formula | C28H45NO4S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | [(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] pentanoate;[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-thiocyanatoacetate |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(OC(=O)CSC#N)C2.CCCCC(=O)O[C@H]1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C15H26O2.C13H19NO2S/c1-5-6-7-13(16)17-12-10-11-8-9-15(12,4)14(11,2)3;1-12(2)9-4-5-13(12,3)10(6-9)16-11(15)7-17-8-14/h11-12H,5-10H2,1-4H3;9-10H,4-7H2,1-3H3/t11-,12+,15-;9-,10?,13-/m11/s1 |
| InChIKey | AYYLDUGUQASZIG-COLAZYQYSA-N |
| XLogP | 6.89 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|